C19H31N3O3 — CID 91763945
N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 91763945) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 91763945 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1NC(=O)CCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C19H31N3O3/c1-13(2)8-11-25-18-9-10-24-12-17(18)20-19(23)7-6-16-14(3)21-22(5)15(16)4/h8,17-18H,6-7,9-12H2,1-5H3,(H,20,23)/t17-,18+/m1/s1 |
| InChIKey | WFYOKHZPCOMETJ-MSOLQXFVSA-N |
| XLogP | 2.23 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|