C21H27N3O3 — CID 91795862
N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-(2-phenylimidazol-1-yl)acetamide (PubChem CID 91795862) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-(2-phenylimidazol-1-yl)acetamide.
| Compound Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-(2-phenylimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 91795862 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-2-(2-phenylimidazol-1-yl)acetamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1NC(=O)Cn1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C21H27N3O3/c1-16(2)8-13-27-19-9-12-26-15-18(19)23-20(25)14-24-11-10-22-21(24)17-6-4-3-5-7-17/h3-8,10-11,18-19H,9,12-15H2,1-2H3,(H,23,25)/t18-,19+/m1/s1 |
| InChIKey | XRUBQJHCTYZMDS-MOPGFXCFSA-N |
| XLogP | 2.81 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|