C21H26N4O3 — CID 90647424
2-amino-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-phenylpyrimidine-5-carboxamide (PubChem CID 90647424) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-amino-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-phenylpyrimidine-5-carboxamide.
| Compound Name | 2-amino-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90647424 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-amino-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-phenylpyrimidine-5-carboxamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1NC(=O)c1cnc(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H26N4O3/c1-14(2)8-11-28-18-9-10-27-13-17(18)24-20(26)16-12-23-21(22)25-19(16)15-6-4-3-5-7-15/h3-8,12,17-18H,9-11,13H2,1-2H3,(H,24,26)(H2,22,23,25)/t17-,18+/m1/s1 |
| InChIKey | DZCXXXOZWYZTGM-MSOLQXFVSA-N |
| XLogP | 2.60 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|