C15H19F2NO2 — CID 51537876
3-(difluoromethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide (PubChem CID 51537876) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 51537876 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-(difluoromethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H19F2NO2/c1-10-5-2-3-8-13(10)18-14(19)11-6-4-7-12(9-11)20-15(16)17/h4,6-7,9-10,13,15H,2-3,5,8H2,1H3,(H,18,19)/t10-,13-/m1/s1 |
| InChIKey | VINJMIKVPYFQOX-ZWNOBZJWSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |