C14H25NO4 — CID 91783033
N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-2,2,3-trimethylbut-3-enamide (PubChem CID 91783033) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-2,2,3-trimethylbut-3-enamide.
| Compound Name | N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-2,2,3-trimethylbut-3-enamide |
|---|---|
| PubChem CID | 91783033 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-2,2,3-trimethylbut-3-enamide |
| SMILES | C=C(C)C(C)(C)C(=O)N[C@@H]1CCOC[C@H]1OCCO |
| InChI | InChI=1S/C14H25NO4/c1-10(2)14(3,4)13(17)15-11-5-7-18-9-12(11)19-8-6-16/h11-12,16H,1,5-9H2,2-4H3,(H,15,17)/t11-,12-/m1/s1 |
| InChIKey | QZGMORWZAAQJPH-VXGBXAGGSA-N |
| XLogP | 0.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|