C21H23FN2O4 — CID 175643754
1-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-3-[(3-fluorophenyl)methyl]urea (PubChem CID 175643754) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-3-[(3-fluorophenyl)methyl]urea.
| Compound Name | 1-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-3-[(3-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 175643754 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-3-[(3-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(F)c1)NC1CCC(Oc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H23FN2O4/c22-15-3-1-2-14(10-15)12-23-21(25)24-16-4-6-17(7-5-16)28-18-8-9-19-20(11-18)27-13-26-19/h1-3,8-11,16-17H,4-7,12-13H2,(H2,23,24,25) |
| InChIKey | BZWHGZOOSUGIPR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |