C18H25FN2O3 — CID 86842992
[4-(ethylcarbamoylamino)cyclohexyl] 3-(3-fluorophenyl)propanoate (PubChem CID 86842992) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] 3-(3-fluorophenyl)propanoate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] 3-(3-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 86842992 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] 3-(3-fluorophenyl)propanoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)CCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H25FN2O3/c1-2-20-18(23)21-15-7-9-16(10-8-15)24-17(22)11-6-13-4-3-5-14(19)12-13/h3-5,12,15-16H,2,6-11H2,1H3,(H2,20,21,23) |
| InChIKey | YKTUTNUUNHHANO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |