C22H25FN2O3 — CID 60537612
N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(3-fluorophenyl)propanamide (PubChem CID 60537612) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(3-fluorophenyl)propanamide.
| Compound Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 60537612 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(3-fluorophenyl)propanamide |
| SMILES | O=C(CCc1cccc(F)c1)NCCc1ccc(OCC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C22H25FN2O3/c23-18-3-1-2-17(14-18)6-11-21(26)24-13-12-16-4-9-20(10-5-16)28-15-22(27)25-19-7-8-19/h1-5,9-10,14,19H,6-8,11-13,15H2,(H,24,26)(H,25,27) |
| InChIKey | DCMUPJMJTBAVBO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |