C21H22F2N2O4 — CID 55893056
N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(difluoromethoxy)benzamide (PubChem CID 55893056) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(difluoromethoxy)benzamide.
| Compound Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 55893056 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[2-[4-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]ethyl]-3-(difluoromethoxy)benzamide |
| SMILES | O=C(COc1ccc(CCNC(=O)c2cccc(OC(F)F)c2)cc1)NC1CC1 |
| InChI | InChI=1S/C21H22F2N2O4/c22-21(23)29-18-3-1-2-15(12-18)20(27)24-11-10-14-4-8-17(9-5-14)28-13-19(26)25-16-6-7-16/h1-5,8-9,12,16,21H,6-7,10-11,13H2,(H,24,27)(H,25,26) |
| InChIKey | VDFXOAMQTGQLFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |