C19H19F2NO4 — CID 78808116
2-(3-acetylphenoxy)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 78808116) has the molecular formula C19H19F2NO4 and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 78808116 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)NCCc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C19H19F2NO4/c1-13(23)15-3-2-4-17(11-15)25-12-18(24)22-10-9-14-5-7-16(8-6-14)26-19(20)21/h2-8,11,19H,9-10,12H2,1H3,(H,22,24) |
| InChIKey | ZSTPRZUEHSKEBI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |