C23H27NO5 — CID 8840794
[2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(3-acetylphenoxy)acetate (PubChem CID 8840794) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(3-acetylphenoxy)acetate.
| Compound Name | [2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(3-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 8840794 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-oxo-2-[2-(4-propan-2-ylphenyl)ethylamino]ethyl] 2-(3-acetylphenoxy)acetate |
| SMILES | CC(=O)c1cccc(OCC(=O)OCC(=O)NCCc2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C23H27NO5/c1-16(2)19-9-7-18(8-10-19)11-12-24-22(26)14-29-23(27)15-28-21-6-4-5-20(13-21)17(3)25/h4-10,13,16H,11-12,14-15H2,1-3H3,(H,24,26) |
| InChIKey | JVTMKHZRXQEZTK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |