C14H15FN2O4 — CID 8589718
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate (PubChem CID 8589718) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8589718 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1cccc(F)c1)NC(=O)NC1CC1 |
| InChI | InChI=1S/C14H15FN2O4/c15-10-3-1-2-9(6-10)7-13(19)21-8-12(18)17-14(20)16-11-4-5-11/h1-3,6,11H,4-5,7-8H2,(H2,16,17,18,20) |
| InChIKey | RDEHOXPQYBOESK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |