C17H18N2O5 — CID 176505408
N-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-1,2-oxazole-5-carboxamide (PubChem CID 176505408) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 176505408 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)cyclohexyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCC(Oc2ccc3c(c2)OCO3)CC1)c1ccno1 |
| InChI | InChI=1S/C17H18N2O5/c20-17(15-7-8-18-24-15)19-11-1-3-12(4-2-11)23-13-5-6-14-16(9-13)22-10-21-14/h5-9,11-12H,1-4,10H2,(H,19,20) |
| InChIKey | ZLZPQJHSQCXIGD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |