C20H21N3O4 — CID 90633289
(E)-3-(1,3-benzodioxol-5-yl)-N-(4-pyrimidin-2-yloxycyclohexyl)prop-2-enamide (PubChem CID 90633289) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(4-pyrimidin-2-yloxycyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-pyrimidin-2-yloxycyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 90633289 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-pyrimidin-2-yloxycyclohexyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NC1CCC(Oc2ncccn2)CC1 |
| InChI | InChI=1S/C20H21N3O4/c24-19(9-3-14-2-8-17-18(12-14)26-13-25-17)23-15-4-6-16(7-5-15)27-20-21-10-1-11-22-20/h1-3,8-12,15-16H,4-7,13H2,(H,23,24)/b9-3+ |
| InChIKey | JYJMJUPDFLOJBH-YCRREMRBSA-N |
| XLogP | 2.72 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|