C16H19NO4 — CID 43389294
(E)-3-(1,3-benzodioxol-5-yl)-N-(4-hydroxycyclohexyl)prop-2-enamide (PubChem CID 43389294) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(4-hydroxycyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 43389294 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-hydroxycyclohexyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H19NO4/c18-13-5-3-12(4-6-13)17-16(19)8-2-11-1-7-14-15(9-11)21-10-20-14/h1-2,7-9,12-13,18H,3-6,10H2,(H,17,19)/b8-2+ |
| InChIKey | LFYPDPMSJDGRDK-KRXBUXKQSA-N |
| XLogP | 1.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|