C22H20N2O6 — CID 7255637
(Z)-3-(1,3-benzodioxol-5-yl)-N-[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]prop-2-enamide (PubChem CID 7255637) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7255637 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc2c(c1)OCO2)N[C@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C22H20N2O6/c25-21(6-2-14-1-4-18-19(9-14)30-13-29-18)23-15-10-22(26)24(12-15)16-3-5-17-20(11-16)28-8-7-27-17/h1-6,9,11,15H,7-8,10,12-13H2,(H,23,25)/b6-2-/t15-/m0/s1 |
| InChIKey | ZVCCNLVBPVHDSK-ZBBQIYFKSA-N |
| XLogP | 2.12 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|