C23H24N2O4 — CID 1286179
2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-cyclohexylbenzamide (PubChem CID 1286179) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-cyclohexylbenzamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 1286179 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-cyclohexylbenzamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H24N2O4/c26-22(13-11-16-10-12-20-21(14-16)29-15-28-20)25-19-9-5-4-8-18(19)23(27)24-17-6-2-1-3-7-17/h4-5,8-14,17H,1-3,6-7,15H2,(H,24,27)(H,25,26) |
| InChIKey | BZKNXPWTAOOTSX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|