C14H16N4O3 — CID 91626018
N-(4-pyrazin-2-yloxycyclohexyl)-1,2-oxazole-5-carboxamide (PubChem CID 91626018) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-(4-pyrazin-2-yloxycyclohexyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-pyrazin-2-yloxycyclohexyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91626018 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-(4-pyrazin-2-yloxycyclohexyl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCC(Oc2cnccn2)CC1)c1ccno1 |
| InChI | InChI=1S/C14H16N4O3/c19-14(12-5-6-17-21-12)18-10-1-3-11(4-2-10)20-13-9-15-7-8-16-13/h5-11H,1-4H2,(H,18,19) |
| InChIKey | SOUVDSVDILJKFW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |