C20H21N5O3 — CID 126778156
4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-pyrazin-2-yloxycyclohexyl)benzamide (PubChem CID 126778156) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-pyrazin-2-yloxycyclohexyl)benzamide.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-pyrazin-2-yloxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 126778156 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-pyrazin-2-yloxycyclohexyl)benzamide |
| SMILES | Cc1noc(-c2ccc(C(=O)NC3CCC(Oc4cnccn4)CC3)cc2)n1 |
| InChI | InChI=1S/C20H21N5O3/c1-13-23-20(28-25-13)15-4-2-14(3-5-15)19(26)24-16-6-8-17(9-7-16)27-18-12-21-10-11-22-18/h2-5,10-12,16-17H,6-9H2,1H3,(H,24,26) |
| InChIKey | BSEWLPBVIDNJQO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |