C17H26N2O3 — CID 99622073
1-[(2R,4S)-2-phenyloxan-4-yl]-3-(2-propan-2-yloxyethyl)urea (PubChem CID 99622073) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(2R,4S)-2-phenyloxan-4-yl]-3-(2-propan-2-yloxyethyl)urea.
| Compound Name | 1-[(2R,4S)-2-phenyloxan-4-yl]-3-(2-propan-2-yloxyethyl)urea |
|---|---|
| PubChem CID | 99622073 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(2R,4S)-2-phenyloxan-4-yl]-3-(2-propan-2-yloxyethyl)urea |
| SMILES | CC(C)OCCNC(=O)N[C@H]1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H26N2O3/c1-13(2)21-11-9-18-17(20)19-15-8-10-22-16(12-15)14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3,(H2,18,19,20)/t15-,16+/m0/s1 |
| InChIKey | JLXWVQAVJOJXBX-JKSUJKDBSA-N |
| XLogP | 2.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|