C17H21N3O2S — CID 97308509
1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(2R,4S)-2-phenyloxan-4-yl]urea (PubChem CID 97308509) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(2R,4S)-2-phenyloxan-4-yl]urea.
| Compound Name | 1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(2R,4S)-2-phenyloxan-4-yl]urea |
|---|---|
| PubChem CID | 97308509 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-[(2R,4S)-2-phenyloxan-4-yl]urea |
| SMILES | Cc1ncsc1CNC(=O)N[C@H]1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H21N3O2S/c1-12-16(23-11-19-12)10-18-17(21)20-14-7-8-22-15(9-14)13-5-3-2-4-6-13/h2-6,11,14-15H,7-10H2,1H3,(H2,18,20,21)/t14-,15+/m0/s1 |
| InChIKey | YSRVROGEOJBEGQ-LSDHHAIUSA-N |
| XLogP | 3.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |