C17H20N2O2S2 — CID 99706149
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(2R,4R)-2-phenyloxan-4-yl]acetamide (PubChem CID 99706149) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(2R,4R)-2-phenyloxan-4-yl]acetamide.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(2R,4R)-2-phenyloxan-4-yl]acetamide |
|---|---|
| PubChem CID | 99706149 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(2R,4R)-2-phenyloxan-4-yl]acetamide |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)N[C@@H]1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H20N2O2S2/c1-11-15(23-17(22)18-11)10-16(20)19-13-7-8-21-14(9-13)12-5-3-2-4-6-12/h2-6,13-14H,7-10H2,1H3,(H,18,22)(H,19,20)/t13-,14-/m1/s1 |
| InChIKey | RJGXQGKFSSJVNA-ZIAGYGMSSA-N |
| XLogP | 3.69 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|