C17H18FN3O2 — CID 99601199
1-(5-fluoro-2-pyridinyl)-3-[(2S,4S)-2-phenyloxan-4-yl]urea (PubChem CID 99601199) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[(2S,4S)-2-phenyloxan-4-yl]urea.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[(2S,4S)-2-phenyloxan-4-yl]urea |
|---|---|
| PubChem CID | 99601199 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[(2S,4S)-2-phenyloxan-4-yl]urea |
| SMILES | O=C(Nc1ccc(F)cn1)N[C@H]1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H18FN3O2/c18-13-6-7-16(19-11-13)21-17(22)20-14-8-9-23-15(10-14)12-4-2-1-3-5-12/h1-7,11,14-15H,8-10H2,(H2,19,20,21,22)/t14-,15-/m0/s1 |
| InChIKey | NJNMXWAMFGRFAK-GJZGRUSLSA-N |
| XLogP | 3.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |