C20H22N2O3 — CID 75478295
1-(1,3-dihydro-2-benzofuran-5-yl)-3-(2-phenyloxan-4-yl)urea (PubChem CID 75478295) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-3-(2-phenyloxan-4-yl)urea.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-(2-phenyloxan-4-yl)urea |
|---|---|
| PubChem CID | 75478295 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-(2-phenyloxan-4-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)COC2)NC1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O3/c23-20(21-17-7-6-15-12-24-13-16(15)10-17)22-18-8-9-25-19(11-18)14-4-2-1-3-5-14/h1-7,10,18-19H,8-9,11-13H2,(H2,21,22,23) |
| InChIKey | OJBTVEZXCPGMJM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |