C19H20N2O3 — CID 129397274
1-(2,3-dihydro-1-benzofuran-5-yl)-3-[(2S,3R)-2-phenyloxolan-3-yl]urea (PubChem CID 129397274) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-3-[(2S,3R)-2-phenyloxolan-3-yl]urea.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-[(2S,3R)-2-phenyloxolan-3-yl]urea |
|---|---|
| PubChem CID | 129397274 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-[(2S,3R)-2-phenyloxolan-3-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)CCO2)N[C@@H]1CCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c22-19(20-15-6-7-17-14(12-15)8-10-23-17)21-16-9-11-24-18(16)13-4-2-1-3-5-13/h1-7,12,16,18H,8-11H2,(H2,20,21,22)/t16-,18+/m1/s1 |
| InChIKey | UIOARIITZWRPFA-AEFFLSMTSA-N |
| XLogP | 3.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |