C17H18N2O4 — CID 110866492
1-(2,3-dihydro-1-benzofuran-5-yl)-3-(3,4-dimethoxyphenyl)urea (PubChem CID 110866492) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 110866492 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc3c(c2)CCO3)cc1OC |
| InChI | InChI=1S/C17H18N2O4/c1-21-15-6-4-13(10-16(15)22-2)19-17(20)18-12-3-5-14-11(9-12)7-8-23-14/h3-6,9-10H,7-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | QHUIBKDICKXDIZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |