C15H15N3O5S — CID 70694605
[4-(2,3-dihydro-1-benzofuran-5-ylcarbamoylamino)phenyl] sulfamate (PubChem CID 70694605) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is [4-(2,3-dihydro-1-benzofuran-5-ylcarbamoylamino)phenyl] sulfamate.
| Compound Name | [4-(2,3-dihydro-1-benzofuran-5-ylcarbamoylamino)phenyl] sulfamate |
|---|---|
| PubChem CID | 70694605 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [4-(2,3-dihydro-1-benzofuran-5-ylcarbamoylamino)phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(NC(=O)Nc2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C15H15N3O5S/c16-24(20,21)23-13-4-1-11(2-5-13)17-15(19)18-12-3-6-14-10(9-12)7-8-22-14/h1-6,9H,7-8H2,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | LEHVPTZHETYTTO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |