C20H25N3O2 — CID 129381914
1-[(2S,4S)-2-phenyloxan-4-yl]-3-[(1S)-1-pyridin-4-ylpropyl]urea (PubChem CID 129381914) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(2S,4S)-2-phenyloxan-4-yl]-3-[(1S)-1-pyridin-4-ylpropyl]urea.
| Compound Name | 1-[(2S,4S)-2-phenyloxan-4-yl]-3-[(1S)-1-pyridin-4-ylpropyl]urea |
|---|---|
| PubChem CID | 129381914 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[(2S,4S)-2-phenyloxan-4-yl]-3-[(1S)-1-pyridin-4-ylpropyl]urea |
| SMILES | CC[C@H](NC(=O)N[C@H]1CCO[C@H](c2ccccc2)C1)c1ccncc1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-18(15-8-11-21-12-9-15)23-20(24)22-17-10-13-25-19(14-17)16-6-4-3-5-7-16/h3-9,11-12,17-19H,2,10,13-14H2,1H3,(H2,22,23,24)/t17-,18-,19-/m0/s1 |
| InChIKey | HYSPYMZUEOGQCQ-FHWLQOOXSA-N |
| XLogP | 3.75 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |