C23H25N3O2 — CID 167748989
1-(1-naphthalen-1-ylethyl)-3-[(2S,4R)-2-pyridin-4-yloxan-4-yl]urea (PubChem CID 167748989) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(1-naphthalen-1-ylethyl)-3-[(2S,4R)-2-pyridin-4-yloxan-4-yl]urea.
| Compound Name | 1-(1-naphthalen-1-ylethyl)-3-[(2S,4R)-2-pyridin-4-yloxan-4-yl]urea |
|---|---|
| PubChem CID | 167748989 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(1-naphthalen-1-ylethyl)-3-[(2S,4R)-2-pyridin-4-yloxan-4-yl]urea |
| SMILES | CC(NC(=O)N[C@@H]1CCO[C@H](c2ccncc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H25N3O2/c1-16(20-8-4-6-17-5-2-3-7-21(17)20)25-23(27)26-19-11-14-28-22(15-19)18-9-12-24-13-10-18/h2-10,12-13,16,19,22H,11,14-15H2,1H3,(H2,25,26,27)/t16?,19-,22+/m1/s1 |
| InChIKey | HCHIYERPSADBNC-PKAPETAZSA-N |
| XLogP | 4.52 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |