C15H17N — CID 16775384
N-(1-naphthalen-1-ylethyl)cyclopropanamine (PubChem CID 16775384) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)cyclopropanamine.
| Compound Name | N-(1-naphthalen-1-ylethyl)cyclopropanamine |
|---|---|
| PubChem CID | 16775384 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)cyclopropanamine |
| SMILES | CC(NC1CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H17N/c1-11(16-13-9-10-13)14-8-4-6-12-5-2-3-7-15(12)14/h2-8,11,13,16H,9-10H2,1H3 |
| InChIKey | CSPUFHAJTUOAER-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |