C24H25NO2 — CID 68781148
4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]benzoic acid (PubChem CID 68781148) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]benzoic acid.
| Compound Name | 4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]benzoic acid |
|---|---|
| PubChem CID | 68781148 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]benzoic acid |
| SMILES | CC(NC1CCC(c2ccc(C(=O)O)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H25NO2/c1-16(22-8-4-6-18-5-2-3-7-23(18)22)25-21-14-13-20(15-21)17-9-11-19(12-10-17)24(26)27/h2-12,16,20-21,25H,13-15H2,1H3,(H,26,27) |
| InChIKey | RVOJEPPTKATVSU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |