C27H32N2O — CID 59617302
N-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cycloheptyl]phenyl]acetamide (PubChem CID 59617302) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is N-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cycloheptyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cycloheptyl]phenyl]acetamide |
|---|---|
| PubChem CID | 59617302 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cycloheptyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2CCCCC(N[C@H](C)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-19(26-13-7-10-22-8-4-6-12-27(22)26)28-25-11-5-3-9-23(18-25)21-14-16-24(17-15-21)29-20(2)30/h4,6-8,10,12-17,19,23,25,28H,3,5,9,11,18H2,1-2H3,(H,29,30)/t19-,23?,25?/m1/s1 |
| InChIKey | MSTNMSBYQCHXQN-KPSOWUDTSA-N |
| XLogP | 6.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |