C27H32N2O2 — CID 77261600
ethyl 2-[4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]anilino]acetate (PubChem CID 77261600) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl 2-[4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]anilino]acetate.
| Compound Name | ethyl 2-[4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]anilino]acetate |
|---|---|
| PubChem CID | 77261600 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | ethyl 2-[4-[3-(1-naphthalen-1-ylethylamino)cyclopentyl]anilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(C2CCC(NC(C)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-3-31-27(30)18-28-23-14-11-20(12-15-23)22-13-16-24(17-22)29-19(2)25-10-6-8-21-7-4-5-9-26(21)25/h4-12,14-15,19,22,24,28-29H,3,13,16-18H2,1-2H3 |
| InChIKey | PBWBPJQNGDIRPA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |