C26H28ClNO2 — CID 142764374
2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]propanoyl chloride (PubChem CID 142764374) has the molecular formula C26H28ClNO2 and a molecular weight of 421.97 g/mol. Its IUPAC name is 2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]propanoyl chloride.
| Compound Name | 2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]propanoyl chloride |
|---|---|
| PubChem CID | 142764374 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]propanoyl chloride |
| SMILES | CC(Oc1ccc([C@@H]2CC[C@H](N[C@H](C)c3cccc4ccccc34)C2)cc1)C(=O)Cl |
| InChI | InChI=1S/C26H28ClNO2/c1-17(24-9-5-7-20-6-3-4-8-25(20)24)28-22-13-10-21(16-22)19-11-14-23(15-12-19)30-18(2)26(27)29/h3-9,11-12,14-15,17-18,21-22,28H,10,13,16H2,1-2H3/t17-,18?,21-,22+/m1/s1 |
| InChIKey | YYMZCJLKHILHOH-HFRPFFAFSA-N |
| XLogP | 6.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|