C26H31NO4 — CID 159697222
formic acid;2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]ethanol (PubChem CID 159697222) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is formic acid;2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]ethanol.
| Compound Name | formic acid;2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 159697222 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | formic acid;2-[4-[(1R,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenoxy]ethanol |
| SMILES | C[C@@H](N[C@H]1CC[C@@H](c2ccc(OCCO)cc2)C1)c1cccc2ccccc12.O=CO |
| InChI | InChI=1S/C25H29NO2.CH2O2/c1-18(24-8-4-6-20-5-2-3-7-25(20)24)26-22-12-9-21(17-22)19-10-13-23(14-11-19)28-16-15-27;2-1-3/h2-8,10-11,13-14,18,21-22,26-27H,9,12,15-17H2,1H3;1H,(H,2,3)/t18-,21-,22+;/m1./s1 |
| InChIKey | MXDXRCJDWBYSDR-SODQIYGASA-N |
| XLogP | 4.90 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|