C26H30N2O — CID 141396256
N-methyl-4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide (PubChem CID 141396256) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is N-methyl-4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide.
| Compound Name | N-methyl-4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 141396256 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-methyl-4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzamide |
| SMILES | CNC(=O)c1ccc([C@H]2CCC[C@H](N[C@H](C)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C26H30N2O/c1-18(24-12-6-8-20-7-3-4-11-25(20)24)28-23-10-5-9-22(17-23)19-13-15-21(16-14-19)26(29)27-2/h3-4,6-8,11-16,18,22-23,28H,5,9-10,17H2,1-2H3,(H,27,29)/t18-,22+,23+/m1/s1 |
| InChIKey | JJCCSXGJXUBBND-LEOXJPRUSA-N |
| XLogP | 5.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |