C31H39N3O2 — CID 68796617
N-(2-morpholin-4-ylethyl)-4-[3-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide (PubChem CID 68796617) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-4-[3-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-4-[3-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68796617 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-4-[3-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide |
| SMILES | CC(NC1CCCC(c2ccc(C(=O)NCCN3CCOCC3)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H39N3O2/c1-23(29-11-5-7-25-6-2-3-10-30(25)29)33-28-9-4-8-27(22-28)24-12-14-26(15-13-24)31(35)32-16-17-34-18-20-36-21-19-34/h2-3,5-7,10-15,23,27-28,33H,4,8-9,16-22H2,1H3,(H,32,35) |
| InChIKey | HTKLSTXLLAAKLE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |