C27H32N2OS — CID 42623590
4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]-N-(2-sulfanylethyl)benzamide (PubChem CID 42623590) has the molecular formula C27H32N2OS and a molecular weight of 432.63 g/mol. Its IUPAC name is 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]-N-(2-sulfanylethyl)benzamide.
| Compound Name | 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]-N-(2-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 42623590 |
| Molecular Formula | C27H32N2OS |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]-N-(2-sulfanylethyl)benzamide |
| SMILES | C[C@@H](NC1CCCC(c2ccc(C(=O)NCCS)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H32N2OS/c1-19(25-11-5-7-21-6-2-3-10-26(21)25)29-24-9-4-8-23(18-24)20-12-14-22(15-13-20)27(30)28-16-17-31/h2-3,5-7,10-15,19,23-24,29,31H,4,8-9,16-18H2,1H3,(H,28,30)/t19-,23?,24?/m1/s1 |
| InChIKey | RFIRISYLQGNHPU-NNAHLOSHSA-N |
| XLogP | 5.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|