C25H29NO — CID 42624182
[4-[(1S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]phenyl]methanol (PubChem CID 42624182) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is [4-[(1S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]phenyl]methanol.
| Compound Name | [4-[(1S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]phenyl]methanol |
|---|---|
| PubChem CID | 42624182 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | [4-[(1S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]phenyl]methanol |
| SMILES | C[C@@H](NC1CCC[C@H](c2ccc(CO)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H29NO/c1-18(24-11-5-7-21-6-2-3-10-25(21)24)26-23-9-4-8-22(16-23)20-14-12-19(17-27)13-15-20/h2-3,5-7,10-15,18,22-23,26-27H,4,8-9,16-17H2,1H3/t18-,22+,23?/m1/s1 |
| InChIKey | NOEZFZADPQCFEZ-QLJVCMTQSA-N |
| XLogP | 5.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |