C44H46N2 — CID 158787446
N-[(1R)-1-naphthalen-1-ylethyl]-3-phenylcyclobutan-1-amine (PubChem CID 158787446) has the molecular formula C44H46N2 and a molecular weight of 602.87 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-1-ylethyl]-3-phenylcyclobutan-1-amine.
| Compound Name | N-[(1R)-1-naphthalen-1-ylethyl]-3-phenylcyclobutan-1-amine |
|---|---|
| PubChem CID | 158787446 |
| Molecular Formula | C44H46N2 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | N-[(1R)-1-naphthalen-1-ylethyl]-3-phenylcyclobutan-1-amine |
| SMILES | C[C@@H](NC1CC(c2ccccc2)C1)c1cccc2ccccc12.C[C@@H](NC1CC(c2ccccc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/2C22H23N/c2*1-16(21-13-7-11-18-10-5-6-12-22(18)21)23-20-14-19(15-20)17-8-3-2-4-9-17/h2*2-13,16,19-20,23H,14-15H2,1H3/t2*16-,19?,20?/m11/s1 |
| InChIKey | IRWAEUIEELAHSU-ZKEPLSHPSA-N |
| XLogP | 10.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |