C25H27NO2 — CID 67296554
2-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]acetic acid (PubChem CID 67296554) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 67296554 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]acetic acid |
| SMILES | C[C@@H](NC1CCC(c2cccc(CC(=O)O)c2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H27NO2/c1-17(23-11-5-8-19-7-2-3-10-24(19)23)26-22-13-12-21(16-22)20-9-4-6-18(14-20)15-25(27)28/h2-11,14,17,21-22,26H,12-13,15-16H2,1H3,(H,27,28)/t17-,21?,22?/m1/s1 |
| InChIKey | NERBENPTEHVBOM-PPNDLDFTSA-N |
| XLogP | 5.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |