C26H30N2 — CID 88918861
cis-(1S,3R)-3-[3-(C,N-dimethylcarbonimidoyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]cyclopentan-1-amine (PubChem CID 88918861) has the molecular formula C26H30N2 and a molecular weight of 370.54 g/mol. Its IUPAC name is cis-(1S,3R)-3-[3-(C,N-dimethylcarbonimidoyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-[3-(C,N-dimethylcarbonimidoyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 88918861 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | cis-(1S,3R)-3-[3-(C,N-dimethylcarbonimidoyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]cyclopentan-1-amine |
| SMILES | C/N=C(\C)c1cccc([C@@H]2CC[C@H](N[C@H](C)c3cccc4ccccc34)C2)c1 |
| InChI | InChI=1S/C26H30N2/c1-18(27-3)21-10-6-11-22(16-21)23-14-15-24(17-23)28-19(2)25-13-7-9-20-8-4-5-12-26(20)25/h4-13,16,19,23-24,28H,14-15,17H2,1-3H3/b27-18+/t19-,23-,24+/m1/s1 |
| InChIKey | UUHATENPNIMJJA-PRFNPFRTSA-N |
| XLogP | 6.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|