C28H33NO2 — CID 68781120
ethyl 3-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoate (PubChem CID 68781120) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is ethyl 3-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoate |
|---|---|
| PubChem CID | 68781120 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | ethyl 3-[3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cccc(C2CCC(N[C@H](C)c3cccc4ccccc34)C2)c1 |
| InChI | InChI=1S/C28H33NO2/c1-3-31-28(30)17-14-21-8-6-11-23(18-21)24-15-16-25(19-24)29-20(2)26-13-7-10-22-9-4-5-12-27(22)26/h4-13,18,20,24-25,29H,3,14-17,19H2,1-2H3/t20-,24?,25?/m1/s1 |
| InChIKey | ISAUCQGVUBCYHX-NWSMCOELSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |