C24H31NO2 — CID 68781218
ethyl 3-[4-[3-(1-phenylethylamino)cyclopentyl]phenyl]propanoate (PubChem CID 68781218) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is ethyl 3-[4-[3-(1-phenylethylamino)cyclopentyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[3-(1-phenylethylamino)cyclopentyl]phenyl]propanoate |
|---|---|
| PubChem CID | 68781218 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | ethyl 3-[4-[3-(1-phenylethylamino)cyclopentyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C2CCC(NC(C)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H31NO2/c1-3-27-24(26)16-11-19-9-12-21(13-10-19)22-14-15-23(17-22)25-18(2)20-7-5-4-6-8-20/h4-10,12-13,18,22-23,25H,3,11,14-17H2,1-2H3 |
| InChIKey | DZYDPRJNEDNGRE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |