C24H31NO3 — CID 139893090
ethyl 2-[3-[(1R,3R)-3-[[(1R)-1-phenylethyl]amino]cyclohexyl]phenoxy]acetate (PubChem CID 139893090) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is ethyl 2-[3-[(1R,3R)-3-[[(1R)-1-phenylethyl]amino]cyclohexyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[(1R,3R)-3-[[(1R)-1-phenylethyl]amino]cyclohexyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139893090 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | ethyl 2-[3-[(1R,3R)-3-[[(1R)-1-phenylethyl]amino]cyclohexyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc([C@@H]2CCC[C@@H](N[C@H](C)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C24H31NO3/c1-3-27-24(26)17-28-23-14-8-12-21(16-23)20-11-7-13-22(15-20)25-18(2)19-9-5-4-6-10-19/h4-6,8-10,12,14,16,18,20,22,25H,3,7,11,13,15,17H2,1-2H3/t18-,20-,22-/m1/s1 |
| InChIKey | FDLFQEFCEDTPDW-SYYKKAFVSA-N |
| XLogP | 5.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |