C24H32N2O5S — CID 75298781
2-[4-[3-[1-(3-ethoxyphenyl)ethylamino]cyclopentyl]phenoxy]-N-methylsulfonylacetamide (PubChem CID 75298781) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[4-[3-[1-(3-ethoxyphenyl)ethylamino]cyclopentyl]phenoxy]-N-methylsulfonylacetamide.
| Compound Name | 2-[4-[3-[1-(3-ethoxyphenyl)ethylamino]cyclopentyl]phenoxy]-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 75298781 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[4-[3-[1-(3-ethoxyphenyl)ethylamino]cyclopentyl]phenoxy]-N-methylsulfonylacetamide |
| SMILES | CCOc1cccc(C(C)NC2CCC(c3ccc(OCC(=O)NS(C)(=O)=O)cc3)C2)c1 |
| InChI | InChI=1S/C24H32N2O5S/c1-4-30-23-7-5-6-19(15-23)17(2)25-21-11-8-20(14-21)18-9-12-22(13-10-18)31-16-24(27)26-32(3,28)29/h5-7,9-10,12-13,15,17,20-21,25H,4,8,11,14,16H2,1-3H3,(H,26,27) |
| InChIKey | VOQFGXXRHMMMJA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |