C22H27NO3 — CID 67296471
2-[3-[3-[[(1R)-1-(3-methylphenyl)ethyl]amino]cyclopentyl]phenoxy]acetic acid (PubChem CID 67296471) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-[3-[3-[[(1R)-1-(3-methylphenyl)ethyl]amino]cyclopentyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-[[(1R)-1-(3-methylphenyl)ethyl]amino]cyclopentyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67296471 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-[3-[3-[[(1R)-1-(3-methylphenyl)ethyl]amino]cyclopentyl]phenoxy]acetic acid |
| SMILES | Cc1cccc([C@@H](C)NC2CCC(c3cccc(OCC(=O)O)c3)C2)c1 |
| InChI | InChI=1S/C22H27NO3/c1-15-5-3-6-17(11-15)16(2)23-20-10-9-19(12-20)18-7-4-8-21(13-18)26-14-22(24)25/h3-8,11,13,16,19-20,23H,9-10,12,14H2,1-2H3,(H,24,25)/t16-,19?,20?/m1/s1 |
| InChIKey | BOIIHUIRDGJCEP-PBPGXSGUSA-N |
| XLogP | 4.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |