C26H28O2 — CID 147632875
2-[3-[3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenyl]acetic acid (PubChem CID 147632875) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[3-[3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 147632875 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-[3-[3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenyl]acetic acid |
| SMILES | C[C@@H](CC1CCC(c2cccc(CC(=O)O)c2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H28O2/c1-18(24-11-5-8-21-7-2-3-10-25(21)24)14-20-12-13-23(16-20)22-9-4-6-19(15-22)17-26(27)28/h2-11,15,18,20,23H,12-14,16-17H2,1H3,(H,27,28)/t18-,20?,23?/m0/s1 |
| InChIKey | GGBCBRNGIROBOD-QRGRWYIGSA-N |
| XLogP | 6.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |