About 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid
2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid (PubChem CID 157186963) has the molecular formula C28H32O3
and a molecular weight of 416.56 g/mol. Its IUPAC name is 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid.
Molecular Properties
| Compound Name | 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid |
| PubChem CID | 157186963 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid |
| SMILES | C[C@@H](C[C@H]1CC[C@@H](c2cccc(OC(C)(C)C(=O)O)c2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H32O3/c1-19(25-13-7-9-21-8-4-5-12-26(21)25)16-20-14-15-23(17-20)22-10-6-11-24(18-22)31-28(2,3)27(29)30/h4-13,18-20,23H,14-17H2,1-3H3,(H,29,30)/t19-,20+,23+/m0/s1 |
| InChIKey | APFSZKHLPMRCJS-MIZPHKNDSA-N |
| XLogP | 7.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid?
The IUPAC name of 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid (CID 157186963) is 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid.
What is the SMILES notation for 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid?
The canonical SMILES for 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid is C[C@@H](C[C@H]1CC[C@@H](c2cccc(OC(C)(C)C(=O)O)c2)C1)c1cccc2ccccc12.
What is the InChIKey of 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid?
The InChIKey is APFSZKHLPMRCJS-MIZPHKNDSA-N. The full InChI is InChI=1S/C28H32O3/c1-19(25-13-7-9-21-8-4-5-12-26(21)25)16-20-14-15-23(17-20)22-10-6-11-24(18-22)31-28(2,3)27(29)30/h4-13,18-20,23H,14-17H2,1-3H3,(H,29,30)/t19-,20+,23+/m0/s1.
What are the key properties of 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid?
2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid has a molecular weight of 416.56 g/mol, XLogP of 7.16, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[3-[(1R,3R)-3-[(2S)-2-naphthalen-1-ylpropyl]cyclopentyl]phenoxy]propanoic acid is sourced from PubChem (CID 157186963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).