C24H29NO4 — CID 11646898
2-methyl-2-[3-[1-(3-phenylpropanoyl)piperidin-3-yl]phenoxy]propanoic acid (PubChem CID 11646898) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-methyl-2-[3-[1-(3-phenylpropanoyl)piperidin-3-yl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[3-[1-(3-phenylpropanoyl)piperidin-3-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 11646898 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-methyl-2-[3-[1-(3-phenylpropanoyl)piperidin-3-yl]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1cccc(C2CCCN(C(=O)CCc3ccccc3)C2)c1)C(=O)O |
| InChI | InChI=1S/C24H29NO4/c1-24(2,23(27)28)29-21-12-6-10-19(16-21)20-11-7-15-25(17-20)22(26)14-13-18-8-4-3-5-9-18/h3-6,8-10,12,16,20H,7,11,13-15,17H2,1-2H3,(H,27,28) |
| InChIKey | BVGVQANZVSYDCY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |